N-(2,3-dichlorophenyl)-3-(3-nitrophenyl)prop-2-enamide
Chemical Structure Depiction of
N-(2,3-dichlorophenyl)-3-(3-nitrophenyl)prop-2-enamide
N-(2,3-dichlorophenyl)-3-(3-nitrophenyl)prop-2-enamide
Compound characteristics
| Compound ID: | 2042-3040 |
| Compound Name: | N-(2,3-dichlorophenyl)-3-(3-nitrophenyl)prop-2-enamide |
| Molecular Weight: | 337.16 |
| Molecular Formula: | C15 H10 Cl2 N2 O3 |
| Smiles: | C(=C/c1cccc(c1)[N+]([O-])=O)\C(Nc1cccc(c1[Cl])[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 4.9091 |
| logD: | 4.8958 |
| logSw: | -5.2886 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 55.8 |
| InChI Key: | NMCRJVIBLCARGX-UHFFFAOYSA-N |