2-(2H-benzotriazol-2-yl)-4-methylphenyl 2-chloro-5-(diethylsulfamoyl)benzoate
Chemical Structure Depiction of
2-(2H-benzotriazol-2-yl)-4-methylphenyl 2-chloro-5-(diethylsulfamoyl)benzoate
2-(2H-benzotriazol-2-yl)-4-methylphenyl 2-chloro-5-(diethylsulfamoyl)benzoate
Compound characteristics
| Compound ID: | 2053-0082 |
| Compound Name: | 2-(2H-benzotriazol-2-yl)-4-methylphenyl 2-chloro-5-(diethylsulfamoyl)benzoate |
| Molecular Weight: | 498.99 |
| Molecular Formula: | C24 H23 Cl N4 O4 S |
| Smiles: | CCN(CC)S(c1ccc(c(c1)C(=O)Oc1ccc(C)cc1n1nc2ccccc2n1)[Cl])(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.8431 |
| logD: | 5.8431 |
| logSw: | -5.9433 |
| Hydrogen bond acceptors count: | 10 |
| Polar surface area: | 75.533 |
| InChI Key: | LQMFPLMUVJYUSB-UHFFFAOYSA-N |