3-methyl-N-[4-(4-propoxybenzamido)phenyl]benzamide
Chemical Structure Depiction of
3-methyl-N-[4-(4-propoxybenzamido)phenyl]benzamide
3-methyl-N-[4-(4-propoxybenzamido)phenyl]benzamide
Compound characteristics
| Compound ID: | 2072-0582 |
| Compound Name: | 3-methyl-N-[4-(4-propoxybenzamido)phenyl]benzamide |
| Molecular Weight: | 388.47 |
| Molecular Formula: | C24 H24 N2 O3 |
| Smiles: | CCCOc1ccc(cc1)C(Nc1ccc(cc1)NC(c1cccc(C)c1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.1823 |
| logD: | 5.182 |
| logSw: | -5.0362 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 53.839 |
| InChI Key: | AMMHCCAPYWCRBQ-UHFFFAOYSA-N |