4-[(2-chlorophenyl)methyl]-2-{[(1,2-dihydroacenaphthylen-5-yl)imino]methyl}-6-nitrophenol
Chemical Structure Depiction of
4-[(2-chlorophenyl)methyl]-2-{[(1,2-dihydroacenaphthylen-5-yl)imino]methyl}-6-nitrophenol
4-[(2-chlorophenyl)methyl]-2-{[(1,2-dihydroacenaphthylen-5-yl)imino]methyl}-6-nitrophenol
Compound characteristics
| Compound ID: | 2079-0130 |
| Compound Name: | 4-[(2-chlorophenyl)methyl]-2-{[(1,2-dihydroacenaphthylen-5-yl)imino]methyl}-6-nitrophenol |
| Molecular Weight: | 442.9 |
| Molecular Formula: | C26 H19 Cl N2 O3 |
| Smiles: | C1Cc2ccc(c3cccc1c23)/N=C/c1cc(Cc2ccccc2[Cl])cc(c1O)[N+]([O-])=O |
| Stereo: | ACHIRAL |
| logP: | 7.777 |
| logD: | 5.9749 |
| logSw: | -6.3473 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 55.971 |
| InChI Key: | QGFPTXKQJJTOIN-UHFFFAOYSA-N |