N-[2-(3-chlorophenyl)-2H-benzotriazol-5-yl]-4-ethoxybenzamide
Chemical Structure Depiction of
N-[2-(3-chlorophenyl)-2H-benzotriazol-5-yl]-4-ethoxybenzamide
N-[2-(3-chlorophenyl)-2H-benzotriazol-5-yl]-4-ethoxybenzamide
Compound characteristics
| Compound ID: | 2081-0806 |
| Compound Name: | N-[2-(3-chlorophenyl)-2H-benzotriazol-5-yl]-4-ethoxybenzamide |
| Molecular Weight: | 392.84 |
| Molecular Formula: | C21 H17 Cl N4 O2 |
| Smiles: | CCOc1ccc(cc1)C(Nc1ccc2c(c1)nn(c1cccc(c1)[Cl])n2)=O |
| Stereo: | ACHIRAL |
| logP: | 5.273 |
| logD: | 5.2656 |
| logSw: | -5.8374 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 54.487 |
| InChI Key: | DLWNNPVKUDXYEJ-UHFFFAOYSA-N |