N-[2-(4-iodophenyl)-1,3-benzoxazol-5-yl]-3,4,5-trimethoxybenzamide
Chemical Structure Depiction of
N-[2-(4-iodophenyl)-1,3-benzoxazol-5-yl]-3,4,5-trimethoxybenzamide
N-[2-(4-iodophenyl)-1,3-benzoxazol-5-yl]-3,4,5-trimethoxybenzamide
Compound characteristics
| Compound ID: | 2081-1373 |
| Compound Name: | N-[2-(4-iodophenyl)-1,3-benzoxazol-5-yl]-3,4,5-trimethoxybenzamide |
| Molecular Weight: | 530.32 |
| Molecular Formula: | C23 H19 I N2 O5 |
| Smiles: | COc1cc(cc(c1OC)OC)C(Nc1ccc2c(c1)nc(c1ccc(cc1)I)o2)=O |
| Stereo: | ACHIRAL |
| logP: | 5.5379 |
| logD: | 5.5379 |
| logSw: | -5.5249 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 63.118 |
| InChI Key: | WJOPBYHCOHTKPQ-UHFFFAOYSA-N |