1-(3,6-dibromo-9H-carbazol-9-yl)-3-(4-ethoxyanilino)propan-2-ol
Chemical Structure Depiction of
1-(3,6-dibromo-9H-carbazol-9-yl)-3-(4-ethoxyanilino)propan-2-ol
1-(3,6-dibromo-9H-carbazol-9-yl)-3-(4-ethoxyanilino)propan-2-ol
Compound characteristics
| Compound ID: | 2096-0024 |
| Compound Name: | 1-(3,6-dibromo-9H-carbazol-9-yl)-3-(4-ethoxyanilino)propan-2-ol |
| Molecular Weight: | 518.25 |
| Molecular Formula: | C23 H22 Br2 N2 O2 |
| Smiles: | CCOc1ccc(cc1)NCC(Cn1c2ccc(cc2c2cc(ccc12)[Br])[Br])O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 6.8013 |
| logD: | 6.8012 |
| logSw: | -5.8248 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 35.191 |
| InChI Key: | GVPHPWUTLBUVGR-SFHVURJKSA-N |