2-(2-bromophenoxy)-N'-{[4-(dimethylamino)phenyl]methylidene}acetohydrazide
Chemical Structure Depiction of
2-(2-bromophenoxy)-N'-{[4-(dimethylamino)phenyl]methylidene}acetohydrazide
2-(2-bromophenoxy)-N'-{[4-(dimethylamino)phenyl]methylidene}acetohydrazide
Compound characteristics
| Compound ID: | 2099-0106 |
| Compound Name: | 2-(2-bromophenoxy)-N'-{[4-(dimethylamino)phenyl]methylidene}acetohydrazide |
| Molecular Weight: | 376.25 |
| Molecular Formula: | C17 H18 Br N3 O2 |
| Smiles: | CN(C)c1ccc(/C=N/NC(COc2ccccc2[Br])=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 3.4789 |
| logD: | 3.4785 |
| logSw: | -3.7226 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 45.731 |
| InChI Key: | VBGNYJNQYUFTPB-UHFFFAOYSA-N |