4-chloro-N'-[1-(4-methyl-3-nitrophenyl)ethylidene]benzohydrazide
Chemical Structure Depiction of
4-chloro-N'-[1-(4-methyl-3-nitrophenyl)ethylidene]benzohydrazide
4-chloro-N'-[1-(4-methyl-3-nitrophenyl)ethylidene]benzohydrazide
Compound characteristics
| Compound ID: | 2108-1283 |
| Compound Name: | 4-chloro-N'-[1-(4-methyl-3-nitrophenyl)ethylidene]benzohydrazide |
| Molecular Weight: | 331.76 |
| Molecular Formula: | C16 H14 Cl N3 O3 |
| Smiles: | C\C(c1ccc(C)c(c1)[N+]([O-])=O)=N/NC(c1ccc(cc1)[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 4.1816 |
| logD: | 4.0238 |
| logSw: | -4.6278 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 67.923 |
| InChI Key: | YSTWGFNBDLSQFH-UHFFFAOYSA-N |