N'-[(5-bromo-2-hydroxyphenyl)methylidene]-4-chlorobenzohydrazide
Chemical Structure Depiction of
N'-[(5-bromo-2-hydroxyphenyl)methylidene]-4-chlorobenzohydrazide
N'-[(5-bromo-2-hydroxyphenyl)methylidene]-4-chlorobenzohydrazide
Compound characteristics
| Compound ID: | 2108-1299 |
| Compound Name: | N'-[(5-bromo-2-hydroxyphenyl)methylidene]-4-chlorobenzohydrazide |
| Molecular Weight: | 353.6 |
| Molecular Formula: | C14 H10 Br Cl N2 O2 |
| Smiles: | C(\c1cc(ccc1O)[Br])=N/NC(c1ccc(cc1)[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 4.3759 |
| logD: | 3.9108 |
| logSw: | -4.4917 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 52.102 |
| InChI Key: | OBKXDVRCRSLWCP-UHFFFAOYSA-N |