2-(2,4-dichlorophenoxy)-N'-[(thiophen-2-yl)methylidene]acetohydrazide
Chemical Structure Depiction of
2-(2,4-dichlorophenoxy)-N'-[(thiophen-2-yl)methylidene]acetohydrazide
2-(2,4-dichlorophenoxy)-N'-[(thiophen-2-yl)methylidene]acetohydrazide
Compound characteristics
| Compound ID: | 2108-1802 |
| Compound Name: | 2-(2,4-dichlorophenoxy)-N'-[(thiophen-2-yl)methylidene]acetohydrazide |
| Molecular Weight: | 329.2 |
| Molecular Formula: | C13 H10 Cl2 N2 O2 S |
| Smiles: | C(C(N/N=C/c1cccs1)=O)Oc1ccc(cc1[Cl])[Cl] |
| Stereo: | ACHIRAL |
| logP: | 3.7749 |
| logD: | 3.7749 |
| logSw: | -4.0942 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 43.945 |
| InChI Key: | PJVGGAGSHNBIDR-UHFFFAOYSA-N |