2-methoxyethyl 1,6-dimethyl-4-(2-nitrophenyl)-2-oxo-1,2,3,4-tetrahydropyrimidine-5-carboxylate
Chemical Structure Depiction of
2-methoxyethyl 1,6-dimethyl-4-(2-nitrophenyl)-2-oxo-1,2,3,4-tetrahydropyrimidine-5-carboxylate
2-methoxyethyl 1,6-dimethyl-4-(2-nitrophenyl)-2-oxo-1,2,3,4-tetrahydropyrimidine-5-carboxylate
Compound characteristics
| Compound ID: | 2119-2645 |
| Compound Name: | 2-methoxyethyl 1,6-dimethyl-4-(2-nitrophenyl)-2-oxo-1,2,3,4-tetrahydropyrimidine-5-carboxylate |
| Molecular Weight: | 349.34 |
| Molecular Formula: | C16 H19 N3 O6 |
| Smiles: | CC1=C(C(c2ccccc2[N+]([O-])=O)NC(N1C)=O)C(=O)OCCOC |
| Stereo: | RACEMIC MIXTURE |
| logP: | 0.9882 |
| logD: | 0.9817 |
| logSw: | -1.9817 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 90.146 |
| InChI Key: | ODCKOVWHSGSMMP-AWEZNQCLSA-N |