1-(4-tert-butylphenyl)-3-{[5-(4-nitrophenyl)furan-2-yl]methylidene}-5-phenyl-1,3-dihydro-2H-pyrrol-2-one
Chemical Structure Depiction of
1-(4-tert-butylphenyl)-3-{[5-(4-nitrophenyl)furan-2-yl]methylidene}-5-phenyl-1,3-dihydro-2H-pyrrol-2-one
1-(4-tert-butylphenyl)-3-{[5-(4-nitrophenyl)furan-2-yl]methylidene}-5-phenyl-1,3-dihydro-2H-pyrrol-2-one
Compound characteristics
| Compound ID: | 2150-0225 |
| Compound Name: | 1-(4-tert-butylphenyl)-3-{[5-(4-nitrophenyl)furan-2-yl]methylidene}-5-phenyl-1,3-dihydro-2H-pyrrol-2-one |
| Molecular Weight: | 490.56 |
| Molecular Formula: | C31 H26 N2 O4 |
| Smiles: | CC(C)(C)c1ccc(cc1)N1C(=C/C(=C\c2ccc(c3ccc(cc3)[N+]([O-])=O)o2)C1=O)c1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 8.1531 |
| logD: | 8.1531 |
| logSw: | -6.0026 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 55.999 |
| InChI Key: | KDSNMIADNHSKQL-UHFFFAOYSA-N |