5-{[5-(2-methyl-4-nitrophenyl)furan-2-yl]methylidene}-1,3-thiazolidine-2,4-dione
Chemical Structure Depiction of
5-{[5-(2-methyl-4-nitrophenyl)furan-2-yl]methylidene}-1,3-thiazolidine-2,4-dione
5-{[5-(2-methyl-4-nitrophenyl)furan-2-yl]methylidene}-1,3-thiazolidine-2,4-dione
Compound characteristics
| Compound ID: | 2151-0360 |
| Compound Name: | 5-{[5-(2-methyl-4-nitrophenyl)furan-2-yl]methylidene}-1,3-thiazolidine-2,4-dione |
| Molecular Weight: | 330.32 |
| Molecular Formula: | C15 H10 N2 O5 S |
| Smiles: | Cc1cc(ccc1c1ccc(/C=C2/C(NC(=O)S2)=O)o1)[N+]([O-])=O |
| Stereo: | ACHIRAL |
| logP: | 3.1503 |
| logD: | 3.1127 |
| logSw: | -3.5096 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 78.859 |
| InChI Key: | CSEGPJKOBMQLKD-UHFFFAOYSA-N |