(5-{[5-(3-methyl-4-nitrophenyl)furan-2-yl]methylidene}-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)acetic acid
Chemical Structure Depiction of
(5-{[5-(3-methyl-4-nitrophenyl)furan-2-yl]methylidene}-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)acetic acid
(5-{[5-(3-methyl-4-nitrophenyl)furan-2-yl]methylidene}-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)acetic acid
Compound characteristics
| Compound ID: | 2151-0440 |
| Compound Name: | (5-{[5-(3-methyl-4-nitrophenyl)furan-2-yl]methylidene}-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)acetic acid |
| Molecular Weight: | 404.42 |
| Molecular Formula: | C17 H12 N2 O6 S2 |
| Smiles: | Cc1cc(ccc1[N+]([O-])=O)c1ccc(/C=C2/C(N(CC(O)=O)C(=S)S2)=O)o1 |
| Stereo: | ACHIRAL |
| logP: | 2.8823 |
| logD: | -0.2367 |
| logSw: | -3.1608 |
| Hydrogen bond acceptors count: | 13 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 85.748 |
| InChI Key: | ARTDOGPMNXIYND-UHFFFAOYSA-N |