5-({2-[(4-nitrophenyl)methoxy]phenyl}methylidene)-1-(prop-2-en-1-yl)-1,3-diazinane-2,4,6-trione
Chemical Structure Depiction of
5-({2-[(4-nitrophenyl)methoxy]phenyl}methylidene)-1-(prop-2-en-1-yl)-1,3-diazinane-2,4,6-trione
5-({2-[(4-nitrophenyl)methoxy]phenyl}methylidene)-1-(prop-2-en-1-yl)-1,3-diazinane-2,4,6-trione
Compound characteristics
| Compound ID: | 2151-0756 |
| Compound Name: | 5-({2-[(4-nitrophenyl)methoxy]phenyl}methylidene)-1-(prop-2-en-1-yl)-1,3-diazinane-2,4,6-trione |
| Molecular Weight: | 407.38 |
| Molecular Formula: | C21 H17 N3 O6 |
| Smiles: | C=CCN1C(C(=C\c2ccccc2OCc2ccc(cc2)[N+]([O-])=O)\C(NC1=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.3799 |
| logD: | 3.353 |
| logSw: | -3.767 |
| Hydrogen bond acceptors count: | 11 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 94.948 |
| InChI Key: | AZHUQYGLXNJYQV-UHFFFAOYSA-N |