N-(4-benzamido-3-methylphenyl)-2,4-dinitrobenzamide
Chemical Structure Depiction of
N-(4-benzamido-3-methylphenyl)-2,4-dinitrobenzamide
N-(4-benzamido-3-methylphenyl)-2,4-dinitrobenzamide
Compound characteristics
| Compound ID: | 2153-0162 |
| Compound Name: | N-(4-benzamido-3-methylphenyl)-2,4-dinitrobenzamide |
| Molecular Weight: | 420.38 |
| Molecular Formula: | C21 H16 N4 O6 |
| Smiles: | Cc1cc(ccc1NC(c1ccccc1)=O)NC(c1ccc(cc1[N+]([O-])=O)[N+]([O-])=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.7375 |
| logD: | 3.7143 |
| logSw: | -4.1337 |
| Hydrogen bond acceptors count: | 12 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 112.185 |
| InChI Key: | PHPARQDFWUMMKZ-UHFFFAOYSA-N |