3-benzyl-5-[(4-methoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione
Chemical Structure Depiction of
3-benzyl-5-[(4-methoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione
3-benzyl-5-[(4-methoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione
Compound characteristics
| Compound ID: | 2159-2474 |
| Compound Name: | 3-benzyl-5-[(4-methoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
| Molecular Weight: | 325.38 |
| Molecular Formula: | C18 H15 N O3 S |
| Smiles: | COc1ccc(/C=C2/C(N(Cc3ccccc3)C(=O)S2)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 4.2407 |
| logD: | 4.2407 |
| logSw: | -4.3393 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 37.139 |
| InChI Key: | SKSCNLSPWGFJDZ-UHFFFAOYSA-N |