2-[4-(decyloxy)phenyl]-4-[(2,5-dimethoxyphenyl)methylidene]-1,3-oxazol-5(4H)-one
Chemical Structure Depiction of
2-[4-(decyloxy)phenyl]-4-[(2,5-dimethoxyphenyl)methylidene]-1,3-oxazol-5(4H)-one
2-[4-(decyloxy)phenyl]-4-[(2,5-dimethoxyphenyl)methylidene]-1,3-oxazol-5(4H)-one
Compound characteristics
| Compound ID: | 2165-1004 |
| Compound Name: | 2-[4-(decyloxy)phenyl]-4-[(2,5-dimethoxyphenyl)methylidene]-1,3-oxazol-5(4H)-one |
| Molecular Weight: | 465.59 |
| Molecular Formula: | C28 H35 N O5 |
| Smiles: | CCCCCCCCCCOc1ccc(cc1)C1=NC(=C/c2cc(ccc2OC)OC)\C(=O)O1 |
| Stereo: | ACHIRAL |
| logP: | 7.9442 |
| logD: | 7.9442 |
| logSw: | -5.7381 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 52.967 |
| InChI Key: | DGWDBSDEZAIAIN-UHFFFAOYSA-N |