2-(4-methoxyphenoxy)-N'-(propan-2-ylidene)acetohydrazide
Chemical Structure Depiction of
2-(4-methoxyphenoxy)-N'-(propan-2-ylidene)acetohydrazide
2-(4-methoxyphenoxy)-N'-(propan-2-ylidene)acetohydrazide
Compound characteristics
| Compound ID: | 2180-0077 |
| Compound Name: | 2-(4-methoxyphenoxy)-N'-(propan-2-ylidene)acetohydrazide |
| Molecular Weight: | 236.27 |
| Molecular Formula: | C12 H16 N2 O3 |
| Smiles: | CC(C)=NNC(COc1ccc(cc1)OC)=O |
| Stereo: | ACHIRAL |
| logP: | 2.0266 |
| logD: | 2.0252 |
| logSw: | -2.3776 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 49.712 |
| InChI Key: | SIVJRZVBCHYCCA-UHFFFAOYSA-N |