N'-[(2-hydroxyphenyl)methylidene]-2-(4-methoxyphenoxy)acetohydrazide
Chemical Structure Depiction of
N'-[(2-hydroxyphenyl)methylidene]-2-(4-methoxyphenoxy)acetohydrazide
N'-[(2-hydroxyphenyl)methylidene]-2-(4-methoxyphenoxy)acetohydrazide
Compound characteristics
| Compound ID: | 2180-0082 |
| Compound Name: | N'-[(2-hydroxyphenyl)methylidene]-2-(4-methoxyphenoxy)acetohydrazide |
| Molecular Weight: | 300.31 |
| Molecular Formula: | C16 H16 N2 O4 |
| Smiles: | COc1ccc(cc1)OCC(N/N=C/c1ccccc1O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.8967 |
| logD: | 2.8954 |
| logSw: | -3.1379 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 66.932 |
| InChI Key: | FCBCOYGKPYOXPV-UHFFFAOYSA-N |