4-[(2-{[(naphthalen-1-yl)oxy]acetyl}hydrazinylidene)methyl]phenyl 4-(2,4-dichlorophenoxy)butanoate
Chemical Structure Depiction of
4-[(2-{[(naphthalen-1-yl)oxy]acetyl}hydrazinylidene)methyl]phenyl 4-(2,4-dichlorophenoxy)butanoate
4-[(2-{[(naphthalen-1-yl)oxy]acetyl}hydrazinylidene)methyl]phenyl 4-(2,4-dichlorophenoxy)butanoate
Compound characteristics
| Compound ID: | 2180-0212 |
| Compound Name: | 4-[(2-{[(naphthalen-1-yl)oxy]acetyl}hydrazinylidene)methyl]phenyl 4-(2,4-dichlorophenoxy)butanoate |
| Molecular Weight: | 551.43 |
| Molecular Formula: | C29 H24 Cl2 N2 O5 |
| Smiles: | C(CC(=O)Oc1ccc(/C=N/NC(COc2cccc3ccccc23)=O)cc1)COc1ccc(cc1[Cl])[Cl] |
| Stereo: | ACHIRAL |
| logP: | 6.8996 |
| logD: | 6.8993 |
| logSw: | -6.8475 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 69.942 |
| InChI Key: | DTUHHJQAQMXIBH-UHFFFAOYSA-N |