4-[(3,4-dimethoxyphenyl)methylidene]-2-(5-methyl-3-phenyl-1,2-oxazol-4-yl)-1,3-oxazol-5(4H)-one
Chemical Structure Depiction of
4-[(3,4-dimethoxyphenyl)methylidene]-2-(5-methyl-3-phenyl-1,2-oxazol-4-yl)-1,3-oxazol-5(4H)-one
4-[(3,4-dimethoxyphenyl)methylidene]-2-(5-methyl-3-phenyl-1,2-oxazol-4-yl)-1,3-oxazol-5(4H)-one
Compound characteristics
| Compound ID: | 2192-1230 |
| Compound Name: | 4-[(3,4-dimethoxyphenyl)methylidene]-2-(5-methyl-3-phenyl-1,2-oxazol-4-yl)-1,3-oxazol-5(4H)-one |
| Molecular Weight: | 390.39 |
| Molecular Formula: | C22 H18 N2 O5 |
| Smiles: | Cc1c(C2=NC(=C/c3ccc(c(c3)OC)OC)\C(=O)O2)c(c2ccccc2)no1 |
| Stereo: | ACHIRAL |
| logP: | 3.0151 |
| logD: | 3.0151 |
| logSw: | -3.353 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 67.597 |
| InChI Key: | YYJDQVLZNONKNX-UHFFFAOYSA-N |