4-[(5-bromo-2-methoxyphenyl)methylidene]-2-[2-(2-methoxyphenyl)ethenyl]-1,3-oxazol-5(4H)-one
Chemical Structure Depiction of
4-[(5-bromo-2-methoxyphenyl)methylidene]-2-[2-(2-methoxyphenyl)ethenyl]-1,3-oxazol-5(4H)-one
4-[(5-bromo-2-methoxyphenyl)methylidene]-2-[2-(2-methoxyphenyl)ethenyl]-1,3-oxazol-5(4H)-one
Compound characteristics
| Compound ID: | 2192-1453 |
| Compound Name: | 4-[(5-bromo-2-methoxyphenyl)methylidene]-2-[2-(2-methoxyphenyl)ethenyl]-1,3-oxazol-5(4H)-one |
| Molecular Weight: | 414.25 |
| Molecular Formula: | C20 H16 Br N O4 |
| Smiles: | COc1ccccc1/C=C/C1=NC(=C/c2cc(ccc2OC)[Br])\C(=O)O1 |
| Stereo: | ACHIRAL |
| logP: | 5.0079 |
| logD: | 5.0079 |
| logSw: | -4.8428 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 45.782 |
| InChI Key: | QTDHCRLPDLVYTO-UHFFFAOYSA-N |