4-[(4-bromothiophen-2-yl)methylidene]-2-[2-(2-methoxyphenyl)ethenyl]-1,3-oxazol-5(4H)-one
Chemical Structure Depiction of
4-[(4-bromothiophen-2-yl)methylidene]-2-[2-(2-methoxyphenyl)ethenyl]-1,3-oxazol-5(4H)-one
4-[(4-bromothiophen-2-yl)methylidene]-2-[2-(2-methoxyphenyl)ethenyl]-1,3-oxazol-5(4H)-one
Compound characteristics
| Compound ID: | 2192-1471 |
| Compound Name: | 4-[(4-bromothiophen-2-yl)methylidene]-2-[2-(2-methoxyphenyl)ethenyl]-1,3-oxazol-5(4H)-one |
| Molecular Weight: | 390.25 |
| Molecular Formula: | C17 H12 Br N O3 S |
| Smiles: | COc1ccccc1/C=C/C1=NC(=C/c2cc(cs2)[Br])\C(=O)O1 |
| Stereo: | ACHIRAL |
| logP: | 4.665 |
| logD: | 4.665 |
| logSw: | -4.6454 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 39.17 |
| InChI Key: | FAQMKRBXWCXSHA-UHFFFAOYSA-N |