3-(diethylsulfamoyl)-N-(5-ethyl-1,3,4-thiadiazol-2-yl)benzamide
Chemical Structure Depiction of
3-(diethylsulfamoyl)-N-(5-ethyl-1,3,4-thiadiazol-2-yl)benzamide
3-(diethylsulfamoyl)-N-(5-ethyl-1,3,4-thiadiazol-2-yl)benzamide
Compound characteristics
| Compound ID: | 2201-0141 |
| Compound Name: | 3-(diethylsulfamoyl)-N-(5-ethyl-1,3,4-thiadiazol-2-yl)benzamide |
| Molecular Weight: | 368.47 |
| Molecular Formula: | C15 H20 N4 O3 S2 |
| Smiles: | CCc1nnc(NC(c2cccc(c2)S(N(CC)CC)(=O)=O)=O)s1 |
| Stereo: | ACHIRAL |
| logP: | 2.7169 |
| logD: | 1.3859 |
| logSw: | -3.3105 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 78.466 |
| InChI Key: | TUQFAGJBJBESRN-UHFFFAOYSA-N |