naphthalen-2-yl 2-chloro-4-nitrobenzoate
Chemical Structure Depiction of
naphthalen-2-yl 2-chloro-4-nitrobenzoate
naphthalen-2-yl 2-chloro-4-nitrobenzoate
Compound characteristics
| Compound ID: | 2216-0024 |
| Compound Name: | naphthalen-2-yl 2-chloro-4-nitrobenzoate |
| Molecular Weight: | 327.72 |
| Molecular Formula: | C17 H10 Cl N O4 |
| Smiles: | c1ccc2cc(ccc2c1)OC(c1ccc(cc1[Cl])[N+]([O-])=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.1476 |
| logD: | 5.1476 |
| logSw: | -5.7824 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 53.726 |
| InChI Key: | FLWCPKIKGPAFOI-UHFFFAOYSA-N |