3-fluoro-N-(2-oxo-2-{2-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylidene]hydrazinyl}ethyl)benzamide
Chemical Structure Depiction of
3-fluoro-N-(2-oxo-2-{2-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylidene]hydrazinyl}ethyl)benzamide
3-fluoro-N-(2-oxo-2-{2-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylidene]hydrazinyl}ethyl)benzamide
Compound characteristics
| Compound ID: | 2235-0453 |
| Compound Name: | 3-fluoro-N-(2-oxo-2-{2-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylidene]hydrazinyl}ethyl)benzamide |
| Molecular Weight: | 367.42 |
| Molecular Formula: | C21 H22 F N3 O2 |
| Smiles: | C/C(c1ccc2CCCCc2c1)=N/NC(CNC(c1cccc(c1)F)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.2804 |
| logD: | 4.2804 |
| logSw: | -4.3182 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 59.234 |
| InChI Key: | OSZKYDKJQXRRBX-UHFFFAOYSA-N |