4-tert-butyl-N-[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]benzamide
Chemical Structure Depiction of
4-tert-butyl-N-[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]benzamide
4-tert-butyl-N-[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]benzamide
Compound characteristics
| Compound ID: | 2237-0123 |
| Compound Name: | 4-tert-butyl-N-[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]benzamide |
| Molecular Weight: | 367.47 |
| Molecular Formula: | C20 H21 N3 O2 S |
| Smiles: | CC(C)(C)c1ccc(cc1)C(Nc1nnc(c2ccc(cc2)OC)s1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.6077 |
| logD: | 5.601 |
| logSw: | -5.4725 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 54.147 |
| InChI Key: | PNVUCVZSKCFLAG-UHFFFAOYSA-N |