prop-2-en-1-yl 2-chloro-5-{5-[(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]furan-2-yl}benzoate
Chemical Structure Depiction of
prop-2-en-1-yl 2-chloro-5-{5-[(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]furan-2-yl}benzoate
prop-2-en-1-yl 2-chloro-5-{5-[(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]furan-2-yl}benzoate
Compound characteristics
| Compound ID: | 2237-1899 |
| Compound Name: | prop-2-en-1-yl 2-chloro-5-{5-[(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]furan-2-yl}benzoate |
| Molecular Weight: | 428.83 |
| Molecular Formula: | C21 H17 Cl N2 O6 |
| Smiles: | CN1C(C(=Cc2ccc(c3ccc(c(c3)C(=O)OCC=C)[Cl])o2)C(N(C)C1=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.0357 |
| logD: | 4.0357 |
| logSw: | -4.4924 |
| Hydrogen bond acceptors count: | 10 |
| Polar surface area: | 73.743 |
| InChI Key: | AZDBZBJRVOHTJZ-UHFFFAOYSA-N |