N-[4-chloro-3-(5-ethyl-1,3-benzoxazol-2-yl)phenyl]-2-nitrobenzamide
Chemical Structure Depiction of
N-[4-chloro-3-(5-ethyl-1,3-benzoxazol-2-yl)phenyl]-2-nitrobenzamide
N-[4-chloro-3-(5-ethyl-1,3-benzoxazol-2-yl)phenyl]-2-nitrobenzamide
Compound characteristics
| Compound ID: | 2239-0440 |
| Compound Name: | N-[4-chloro-3-(5-ethyl-1,3-benzoxazol-2-yl)phenyl]-2-nitrobenzamide |
| Molecular Weight: | 421.84 |
| Molecular Formula: | C22 H16 Cl N3 O4 |
| Smiles: | CCc1ccc2c(c1)nc(c1cc(ccc1[Cl])NC(c1ccccc1[N+]([O-])=O)=O)o2 |
| Stereo: | ACHIRAL |
| logP: | 5.6207 |
| logD: | 5.4176 |
| logSw: | -5.9082 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 73.22 |
| InChI Key: | SQEOSPNSKDQMNA-UHFFFAOYSA-N |