dimethyl 5-{[2-(2,4-dichlorophenyl)-3-methylquinoline-4-carbonyl]amino}benzene-1,3-dicarboxylate
Chemical Structure Depiction of
dimethyl 5-{[2-(2,4-dichlorophenyl)-3-methylquinoline-4-carbonyl]amino}benzene-1,3-dicarboxylate
dimethyl 5-{[2-(2,4-dichlorophenyl)-3-methylquinoline-4-carbonyl]amino}benzene-1,3-dicarboxylate
Compound characteristics
| Compound ID: | 2260-5896 |
| Compound Name: | dimethyl 5-{[2-(2,4-dichlorophenyl)-3-methylquinoline-4-carbonyl]amino}benzene-1,3-dicarboxylate |
| Molecular Weight: | 523.37 |
| Molecular Formula: | C27 H20 Cl2 N2 O5 |
| Smiles: | Cc1c(C(Nc2cc(cc(c2)C(=O)OC)C(=O)OC)=O)c2ccccc2nc1c1ccc(cc1[Cl])[Cl] |
| Stereo: | ACHIRAL |
| logP: | 7.1843 |
| logD: | 7.1842 |
| logSw: | -6.5947 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 74.507 |
| InChI Key: | VXKXVBZIBWSYOJ-UHFFFAOYSA-N |