N-(4-fluoro-3-nitrophenyl)-3-phenylpropanamide
Chemical Structure Depiction of
N-(4-fluoro-3-nitrophenyl)-3-phenylpropanamide
N-(4-fluoro-3-nitrophenyl)-3-phenylpropanamide
Compound characteristics
| Compound ID: | 2260-6215 |
| Compound Name: | N-(4-fluoro-3-nitrophenyl)-3-phenylpropanamide |
| Molecular Weight: | 288.28 |
| Molecular Formula: | C15 H13 F N2 O3 |
| Smiles: | C(Cc1ccccc1)C(Nc1ccc(c(c1)[N+]([O-])=O)F)=O |
| Stereo: | ACHIRAL |
| logP: | 3.3564 |
| logD: | 3.1786 |
| logSw: | -3.7513 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 56.197 |
| InChI Key: | AGDQZJPULREBJW-UHFFFAOYSA-N |