3-chloro-N'-[(pyridin-3-yl)methylidene]benzohydrazide
Chemical Structure Depiction of
3-chloro-N'-[(pyridin-3-yl)methylidene]benzohydrazide
3-chloro-N'-[(pyridin-3-yl)methylidene]benzohydrazide
Compound characteristics
| Compound ID: | 2262-1676 |
| Compound Name: | 3-chloro-N'-[(pyridin-3-yl)methylidene]benzohydrazide |
| Molecular Weight: | 259.69 |
| Molecular Formula: | C13 H10 Cl N3 O |
| Smiles: | C(\c1cccnc1)=N/NC(c1cccc(c1)[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 2.6891 |
| logD: | 2.5421 |
| logSw: | -3.6311 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 45.072 |
| InChI Key: | NQAILPIJQPUTRD-UHFFFAOYSA-N |