2-bromo-N'-{[2-hydroxy-3-(prop-2-en-1-yl)phenyl]methylidene}benzohydrazide
Chemical Structure Depiction of
2-bromo-N'-{[2-hydroxy-3-(prop-2-en-1-yl)phenyl]methylidene}benzohydrazide
2-bromo-N'-{[2-hydroxy-3-(prop-2-en-1-yl)phenyl]methylidene}benzohydrazide
Compound characteristics
| Compound ID: | 2262-2194 |
| Compound Name: | 2-bromo-N'-{[2-hydroxy-3-(prop-2-en-1-yl)phenyl]methylidene}benzohydrazide |
| Molecular Weight: | 359.22 |
| Molecular Formula: | C17 H15 Br N2 O2 |
| Smiles: | C=CCc1cccc(/C=N/NC(c2ccccc2[Br])=O)c1O |
| Stereo: | ACHIRAL |
| logP: | 4.2435 |
| logD: | 4.2256 |
| logSw: | -4.304 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 51.033 |
| InChI Key: | MXWCDSAVLYRSGT-UHFFFAOYSA-N |