2-{[2-(1H-benzimidazol-2-yl)hydrazinylidene]methyl}-4-bromo-6-methoxyphenol
Chemical Structure Depiction of
2-{[2-(1H-benzimidazol-2-yl)hydrazinylidene]methyl}-4-bromo-6-methoxyphenol
2-{[2-(1H-benzimidazol-2-yl)hydrazinylidene]methyl}-4-bromo-6-methoxyphenol
Compound characteristics
| Compound ID: | 2262-3600 |
| Compound Name: | 2-{[2-(1H-benzimidazol-2-yl)hydrazinylidene]methyl}-4-bromo-6-methoxyphenol |
| Molecular Weight: | 361.2 |
| Molecular Formula: | C15 H13 Br N4 O2 |
| Smiles: | COc1cc(cc(/C=N/Nc2nc3ccccc3[nH]2)c1O)[Br] |
| Stereo: | ACHIRAL |
| logP: | 3.7143 |
| logD: | 3.674 |
| logSw: | -4.0293 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 64.91 |
| InChI Key: | NYXVXGYWPIQDPE-CAOOACKPSA-N |