2-bromo-N'-[1-(4-fluorophenyl)ethylidene]benzohydrazide
Chemical Structure Depiction of
2-bromo-N'-[1-(4-fluorophenyl)ethylidene]benzohydrazide
2-bromo-N'-[1-(4-fluorophenyl)ethylidene]benzohydrazide
Compound characteristics
| Compound ID: | 2262-4314 |
| Compound Name: | 2-bromo-N'-[1-(4-fluorophenyl)ethylidene]benzohydrazide |
| Molecular Weight: | 335.17 |
| Molecular Formula: | C15 H12 Br F N2 O |
| Smiles: | C\C(c1ccc(cc1)F)=N/NC(c1ccccc1[Br])=O |
| Stereo: | ACHIRAL |
| logP: | 3.4205 |
| logD: | 3.3082 |
| logSw: | -3.7711 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 34.842 |
| InChI Key: | JCKKYNIPYHHYFI-UHFFFAOYSA-N |