6-chloro-2-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)imino]-N-(4-methylphenyl)-2H-1-benzopyran-3-carboxamide
Chemical Structure Depiction of
6-chloro-2-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)imino]-N-(4-methylphenyl)-2H-1-benzopyran-3-carboxamide
6-chloro-2-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)imino]-N-(4-methylphenyl)-2H-1-benzopyran-3-carboxamide
Compound characteristics
| Compound ID: | 2265-3136 |
| Compound Name: | 6-chloro-2-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)imino]-N-(4-methylphenyl)-2H-1-benzopyran-3-carboxamide |
| Molecular Weight: | 473.98 |
| Molecular Formula: | C26 H20 Cl N3 O2 S |
| Smiles: | Cc1ccc(cc1)NC(C1=Cc2cc(ccc2OC/1=N/c1c(C#N)c2CCCCc2s1)[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 6.3921 |
| logD: | 6.392 |
| logSw: | -6.3496 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 55.807 |
| InChI Key: | HBDJIKJTMVWWHK-UHFFFAOYSA-N |