3-(3,5-dioxo-2,3,4,5-tetrahydro-1,2,4-triazin-6-yl)-N'-{[4-(trifluoromethyl)phenyl]methylidene}propanehydrazide
Chemical Structure Depiction of
3-(3,5-dioxo-2,3,4,5-tetrahydro-1,2,4-triazin-6-yl)-N'-{[4-(trifluoromethyl)phenyl]methylidene}propanehydrazide
3-(3,5-dioxo-2,3,4,5-tetrahydro-1,2,4-triazin-6-yl)-N'-{[4-(trifluoromethyl)phenyl]methylidene}propanehydrazide
Compound characteristics
| Compound ID: | 2279-4347 |
| Compound Name: | 3-(3,5-dioxo-2,3,4,5-tetrahydro-1,2,4-triazin-6-yl)-N'-{[4-(trifluoromethyl)phenyl]methylidene}propanehydrazide |
| Molecular Weight: | 355.27 |
| Molecular Formula: | C14 H12 F3 N5 O3 |
| Smiles: | C(CC(N/N=C/c1ccc(cc1)C(F)(F)F)=O)C1C(NC(NN=1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.0791 |
| logD: | 1.0527 |
| logSw: | -2.1465 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 95.912 |
| InChI Key: | DAYMSILPDMRJBI-UHFFFAOYSA-N |