N-(2-methoxy-5-nitrophenyl)adamantane-1-carboxamide
Chemical Structure Depiction of
N-(2-methoxy-5-nitrophenyl)adamantane-1-carboxamide
N-(2-methoxy-5-nitrophenyl)adamantane-1-carboxamide
Compound characteristics
| Compound ID: | 2291-3301 |
| Compound Name: | N-(2-methoxy-5-nitrophenyl)adamantane-1-carboxamide |
| Molecular Weight: | 330.38 |
| Molecular Formula: | C18 H22 N2 O4 |
| Smiles: | COc1ccc(cc1NC(C12CC3CC(CC(C3)C2)C1)=O)[N+]([O-])=O |
| Stereo: | ACHIRAL |
| logP: | 4.497 |
| logD: | 4.2689 |
| logSw: | -4.4943 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 63.677 |
| InChI Key: | AVYYMJNHWMNMTO-UHFFFAOYSA-N |