1-{3-[(2-methyl-5,6,7,8-tetrahydro[1]benzothieno[2,3-d]pyrimidin-4-yl)oxy]phenyl}ethan-1-one
Chemical Structure Depiction of
1-{3-[(2-methyl-5,6,7,8-tetrahydro[1]benzothieno[2,3-d]pyrimidin-4-yl)oxy]phenyl}ethan-1-one
1-{3-[(2-methyl-5,6,7,8-tetrahydro[1]benzothieno[2,3-d]pyrimidin-4-yl)oxy]phenyl}ethan-1-one
Compound characteristics
| Compound ID: | 2292-1921 |
| Compound Name: | 1-{3-[(2-methyl-5,6,7,8-tetrahydro[1]benzothieno[2,3-d]pyrimidin-4-yl)oxy]phenyl}ethan-1-one |
| Molecular Weight: | 338.43 |
| Molecular Formula: | C19 H18 N2 O2 S |
| Smiles: | CC(c1cccc(c1)Oc1c2c3CCCCc3sc2nc(C)n1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.4636 |
| logD: | 4.4636 |
| logSw: | -4.719 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 40.78 |
| InChI Key: | IETLELWNOUNAAQ-UHFFFAOYSA-N |