6-bromo-4-(2-chlorophenyl)-N-(3-methylphenyl)quinazolin-2-amine
Chemical Structure Depiction of
6-bromo-4-(2-chlorophenyl)-N-(3-methylphenyl)quinazolin-2-amine
6-bromo-4-(2-chlorophenyl)-N-(3-methylphenyl)quinazolin-2-amine
Compound characteristics
| Compound ID: | 2295-0075 |
| Compound Name: | 6-bromo-4-(2-chlorophenyl)-N-(3-methylphenyl)quinazolin-2-amine |
| Molecular Weight: | 424.73 |
| Molecular Formula: | C21 H15 Br Cl N3 |
| Smiles: | Cc1cccc(c1)Nc1nc(c2ccccc2[Cl])c2cc(ccc2n1)[Br] |
| Stereo: | ACHIRAL |
| logP: | 7.221 |
| logD: | 7.2183 |
| logSw: | -6.8648 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 29.0701 |
| InChI Key: | IDUJAFMTMRZVJJ-UHFFFAOYSA-N |