methyl 4-{[2-(3-tert-butyl-1H-pyrazole-5-carbonyl)hydrazinylidene]methyl}benzoate
Chemical Structure Depiction of
methyl 4-{[2-(3-tert-butyl-1H-pyrazole-5-carbonyl)hydrazinylidene]methyl}benzoate
methyl 4-{[2-(3-tert-butyl-1H-pyrazole-5-carbonyl)hydrazinylidene]methyl}benzoate
Compound characteristics
| Compound ID: | 2323-2110 |
| Compound Name: | methyl 4-{[2-(3-tert-butyl-1H-pyrazole-5-carbonyl)hydrazinylidene]methyl}benzoate |
| Molecular Weight: | 328.37 |
| Molecular Formula: | C17 H20 N4 O3 |
| Smiles: | CC(C)(C)c1cc(C(N/N=C\c2ccc(cc2)C(=O)OC)=O)[nH]n1 |
| Stereo: | ACHIRAL |
| logP: | 3.4259 |
| logD: | 3.424 |
| logSw: | -3.5686 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 79.489 |
| InChI Key: | BFVKBWNMHUDEKW-UHFFFAOYSA-N |