butan-2-yl 4-(2-bromophenyl)-2-methyl-6-oxo-1,4,5,6-tetrahydropyridine-3-carboxylate
Chemical Structure Depiction of
butan-2-yl 4-(2-bromophenyl)-2-methyl-6-oxo-1,4,5,6-tetrahydropyridine-3-carboxylate
butan-2-yl 4-(2-bromophenyl)-2-methyl-6-oxo-1,4,5,6-tetrahydropyridine-3-carboxylate
Compound characteristics
| Compound ID: | 2326-3138 |
| Compound Name: | butan-2-yl 4-(2-bromophenyl)-2-methyl-6-oxo-1,4,5,6-tetrahydropyridine-3-carboxylate |
| Molecular Weight: | 366.25 |
| Molecular Formula: | C17 H20 Br N O3 |
| Smiles: | CCC(C)OC(C1C(CC(NC=1C)=O)c1ccccc1[Br])=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 3.9042 |
| logD: | 3.1052 |
| logSw: | -4.0531 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 44.755 |
| InChI Key: | DQGFGTYOUVSKNK-UHFFFAOYSA-N |