2-[(4,5-diphenyl-4H-1,2,4-triazol-3-yl)sulfanyl]-N'-[(4-fluorophenyl)methylidene]acetohydrazide
Chemical Structure Depiction of
2-[(4,5-diphenyl-4H-1,2,4-triazol-3-yl)sulfanyl]-N'-[(4-fluorophenyl)methylidene]acetohydrazide
2-[(4,5-diphenyl-4H-1,2,4-triazol-3-yl)sulfanyl]-N'-[(4-fluorophenyl)methylidene]acetohydrazide
Compound characteristics
| Compound ID: | 2357-3498 |
| Compound Name: | 2-[(4,5-diphenyl-4H-1,2,4-triazol-3-yl)sulfanyl]-N'-[(4-fluorophenyl)methylidene]acetohydrazide |
| Molecular Weight: | 431.49 |
| Molecular Formula: | C23 H18 F N5 O S |
| Smiles: | C(C(N/N=C/c1ccc(cc1)F)=O)Sc1nnc(c2ccccc2)n1c1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 4.414 |
| logD: | 4.4138 |
| logSw: | -4.3491 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 60.086 |
| InChI Key: | VYZPHYOIJOOUGU-UHFFFAOYSA-N |