N'-{[4-(dimethylamino)phenyl]methylidene}-1-(4-methylbenzene-1-sulfonyl)piperidine-4-carbohydrazide
Chemical Structure Depiction of
N'-{[4-(dimethylamino)phenyl]methylidene}-1-(4-methylbenzene-1-sulfonyl)piperidine-4-carbohydrazide
N'-{[4-(dimethylamino)phenyl]methylidene}-1-(4-methylbenzene-1-sulfonyl)piperidine-4-carbohydrazide
Compound characteristics
| Compound ID: | 2358-0060 |
| Compound Name: | N'-{[4-(dimethylamino)phenyl]methylidene}-1-(4-methylbenzene-1-sulfonyl)piperidine-4-carbohydrazide |
| Molecular Weight: | 428.55 |
| Molecular Formula: | C22 H28 N4 O3 S |
| Smiles: | Cc1ccc(cc1)S(N1CCC(CC1)C(N/N=C/c1ccc(cc1)N(C)C)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.551 |
| logD: | 3.5497 |
| logSw: | -3.6061 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 70.07 |
| InChI Key: | VVCZIFGBPPDTNW-UHFFFAOYSA-N |