5-amino-3-[2-(2-chloro-5-nitrophenyl)-1-cyanoethenyl]-1-phenyl-1H-pyrazole-4-carbonitrile
Chemical Structure Depiction of
5-amino-3-[2-(2-chloro-5-nitrophenyl)-1-cyanoethenyl]-1-phenyl-1H-pyrazole-4-carbonitrile
5-amino-3-[2-(2-chloro-5-nitrophenyl)-1-cyanoethenyl]-1-phenyl-1H-pyrazole-4-carbonitrile
Compound characteristics
| Compound ID: | 2367-1268 |
| Compound Name: | 5-amino-3-[2-(2-chloro-5-nitrophenyl)-1-cyanoethenyl]-1-phenyl-1H-pyrazole-4-carbonitrile |
| Molecular Weight: | 390.79 |
| Molecular Formula: | C19 H11 Cl N6 O2 |
| Smiles: | [H]N([H])c1c(C#N)c(/C(=C/c2cc(ccc2[Cl])[N+]([O-])=O)C#N)nn1c1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 3.6926 |
| logD: | 3.6926 |
| logSw: | -4.6057 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 101.324 |
| InChI Key: | GDQXUQORWQBHNQ-UHFFFAOYSA-N |