5-amino-3-(1-cyano-2-{1-[(2,4-dichlorophenyl)methyl]-1H-indol-3-yl}ethenyl)-1-phenyl-1H-pyrazole-4-carbonitrile
Chemical Structure Depiction of
5-amino-3-(1-cyano-2-{1-[(2,4-dichlorophenyl)methyl]-1H-indol-3-yl}ethenyl)-1-phenyl-1H-pyrazole-4-carbonitrile
5-amino-3-(1-cyano-2-{1-[(2,4-dichlorophenyl)methyl]-1H-indol-3-yl}ethenyl)-1-phenyl-1H-pyrazole-4-carbonitrile
Compound characteristics
| Compound ID: | 2367-1269 |
| Compound Name: | 5-amino-3-(1-cyano-2-{1-[(2,4-dichlorophenyl)methyl]-1H-indol-3-yl}ethenyl)-1-phenyl-1H-pyrazole-4-carbonitrile |
| Molecular Weight: | 509.4 |
| Molecular Formula: | C28 H18 Cl2 N6 |
| Smiles: | [H]N([H])c1c(C#N)c(/C(=C/c2cn(Cc3ccc(cc3[Cl])[Cl])c3ccccc23)C#N)nn1c1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 6.0849 |
| logD: | 6.0849 |
| logSw: | -6.5374 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 69.674 |
| InChI Key: | RFBTUKRLSOJBMC-UHFFFAOYSA-N |