5-{[4-(benzyloxy)-3-methoxyphenyl]methylidene}-1-(4-methylphenyl)-1,3-diazinane-2,4,6-trione
Chemical Structure Depiction of
5-{[4-(benzyloxy)-3-methoxyphenyl]methylidene}-1-(4-methylphenyl)-1,3-diazinane-2,4,6-trione
5-{[4-(benzyloxy)-3-methoxyphenyl]methylidene}-1-(4-methylphenyl)-1,3-diazinane-2,4,6-trione
Compound characteristics
| Compound ID: | 2368-0371 |
| Compound Name: | 5-{[4-(benzyloxy)-3-methoxyphenyl]methylidene}-1-(4-methylphenyl)-1,3-diazinane-2,4,6-trione |
| Molecular Weight: | 442.47 |
| Molecular Formula: | C26 H22 N2 O5 |
| Smiles: | Cc1ccc(cc1)N1C(C(=C\c2ccc(c(c2)OC)OCc2ccccc2)\C(NC1=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.9523 |
| logD: | 3.6493 |
| logSw: | -4.135 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 68.335 |
| InChI Key: | GMSQHSMYDPMWBB-UHFFFAOYSA-N |