5-{[5-(2-bromo-4-methylphenyl)furan-2-yl]methylidene}-1-(4-methylphenyl)-1,3-diazinane-2,4,6-trione
Chemical Structure Depiction of
5-{[5-(2-bromo-4-methylphenyl)furan-2-yl]methylidene}-1-(4-methylphenyl)-1,3-diazinane-2,4,6-trione
5-{[5-(2-bromo-4-methylphenyl)furan-2-yl]methylidene}-1-(4-methylphenyl)-1,3-diazinane-2,4,6-trione
Compound characteristics
| Compound ID: | 2368-0413 |
| Compound Name: | 5-{[5-(2-bromo-4-methylphenyl)furan-2-yl]methylidene}-1-(4-methylphenyl)-1,3-diazinane-2,4,6-trione |
| Molecular Weight: | 465.3 |
| Molecular Formula: | C23 H17 Br N2 O4 |
| Smiles: | Cc1ccc(cc1)N1C(C(=C/c2ccc(c3ccc(C)cc3[Br])o2)\C(NC1=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.9914 |
| logD: | 4.6787 |
| logSw: | -4.5834 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 60.96 |
| InChI Key: | HBLYZXUTGWWKTD-UHFFFAOYSA-N |